C15H13BrClNO — CID 107999224
3-bromo-4-chloro-N-(2,3-dimethylphenyl)benzamide (PubChem CID 107999224) has the molecular formula C15H13BrClNO and a molecular weight of 338.63 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(2,3-dimethylphenyl)benzamide.
| Compound Name | 3-bromo-4-chloro-N-(2,3-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 107999224 |
| Molecular Formula | C15H13BrClNO |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 3-bromo-4-chloro-N-(2,3-dimethylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(Cl)c(Br)c2)c1C |
| InChI | InChI=1S/C15H13BrClNO/c1-9-4-3-5-14(10(9)2)18-15(19)11-6-7-13(17)12(16)8-11/h3-8H,1-2H3,(H,18,19) |
| InChIKey | HALKIKIILOAFCX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |