C14H15BrClNO2 — CID 107998926
1-(3-bromo-4-chlorophenyl)-1-[5-(methoxymethyl)furan-2-yl]-N-methylmethanamine (PubChem CID 107998926) has the molecular formula C14H15BrClNO2 and a molecular weight of 344.64 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-1-[5-(methoxymethyl)furan-2-yl]-N-methylmethanamine.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-1-[5-(methoxymethyl)furan-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107998926 |
| Molecular Formula | C14H15BrClNO2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-1-[5-(methoxymethyl)furan-2-yl]-N-methylmethanamine |
| SMILES | CNC(c1ccc(Cl)c(Br)c1)c1ccc(COC)o1 |
| InChI | InChI=1S/C14H15BrClNO2/c1-17-14(9-3-5-12(16)11(15)7-9)13-6-4-10(19-13)8-18-2/h3-7,14,17H,8H2,1-2H3 |
| InChIKey | OMMPVDONJXFZOT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |