C16H19BrClNO2 — CID 107998930
N-[(3-bromo-4-chlorophenyl)-[5-(methoxymethyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 107998930) has the molecular formula C16H19BrClNO2 and a molecular weight of 372.69 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)-[5-(methoxymethyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)-[5-(methoxymethyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107998930 |
| Molecular Formula | C16H19BrClNO2 |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)-[5-(methoxymethyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)c(Br)c1)c1ccc(COC)o1 |
| InChI | InChI=1S/C16H19BrClNO2/c1-3-8-19-16(11-4-6-14(18)13(17)9-11)15-7-5-12(21-15)10-20-2/h4-7,9,16,19H,3,8,10H2,1-2H3 |
| InChIKey | SWVXUOFCJHTKPO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |