C16H21BrClNO — CID 107999537
(3-bromo-4-chlorophenyl)-(4,4-diethylpiperidin-1-yl)methanone (PubChem CID 107999537) has the molecular formula C16H21BrClNO and a molecular weight of 358.71 g/mol. Its IUPAC name is (3-bromo-4-chlorophenyl)-(4,4-diethylpiperidin-1-yl)methanone.
| Compound Name | (3-bromo-4-chlorophenyl)-(4,4-diethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107999537 |
| Molecular Formula | C16H21BrClNO |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (3-bromo-4-chlorophenyl)-(4,4-diethylpiperidin-1-yl)methanone |
| SMILES | CCC1(CC)CCN(C(=O)c2ccc(Cl)c(Br)c2)CC1 |
| InChI | InChI=1S/C16H21BrClNO/c1-3-16(4-2)7-9-19(10-8-16)15(20)12-5-6-14(18)13(17)11-12/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | OFFLCJLLYHLJRC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |