C16H30O2 — CID 10800967
(2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]decanal (PubChem CID 10800967) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]decanal.
| Compound Name | (2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]decanal |
|---|---|
| PubChem CID | 10800967 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]decanal |
| SMILES | CCC/C=C/[C@H](O)[C@H](C=O)CCCCCCCC |
| InChI | InChI=1S/C16H30O2/c1-3-5-7-8-9-11-12-15(14-17)16(18)13-10-6-4-2/h10,13-16,18H,3-9,11-12H2,1-2H3/b13-10+/t15-,16-/m0/s1 |
| InChIKey | VPBCPVKVAYTQFO-TZCWYCDXSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|