C10H21F3O2Si — CID 10801202
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutan-1-ol (PubChem CID 10801202) has the molecular formula C10H21F3O2Si and a molecular weight of 258.36 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutan-1-ol.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 10801202 |
| Molecular Formula | C10H21F3O2Si |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCO)C(F)(F)F |
| InChI | InChI=1S/C10H21F3O2Si/c1-9(2,3)16(4,5)15-8(6-7-14)10(11,12)13/h8,14H,6-7H2,1-5H3/t8-/m0/s1 |
| InChIKey | FAEPYVQMJKYKIJ-QMMMGPOBSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|