C11H24F2O3Si — CID 135041139
(3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorobutane-1,4-diol (PubChem CID 135041139) has the molecular formula C11H24F2O3Si and a molecular weight of 270.39 g/mol. Its IUPAC name is (3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorobutane-1,4-diol.
| Compound Name | (3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorobutane-1,4-diol |
|---|---|
| PubChem CID | 135041139 |
| Molecular Formula | C11H24F2O3Si |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorobutane-1,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CO)C(F)(F)CO |
| InChI | InChI=1S/C11H24F2O3Si/c1-10(2,3)17(4,5)16-7-9(6-14)11(12,13)8-15/h9,14-15H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | GRIWVMDJWLUKQA-VIFPVBQESA-N |
| XLogP | 2.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|