C9H20F2O2Si — CID 91467778
3-[butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol (PubChem CID 91467778) has the molecular formula C9H20F2O2Si and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-[butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol.
| Compound Name | 3-[butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 91467778 |
| Molecular Formula | C9H20F2O2Si |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-[butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol |
| SMILES | CCCC[Si](C)(C)OCC(F)(F)CO |
| InChI | InChI=1S/C9H20F2O2Si/c1-4-5-6-14(2,3)13-8-9(10,11)7-12/h12H,4-8H2,1-3H3 |
| InChIKey | MUWOZBOLUXAXBY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|