C14H26O4 — CID 10801206
11-[(3S,5S)-5-methyl-1,2,4-trioxolan-3-yl]undecanal (PubChem CID 10801206) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 11-[(3S,5S)-5-methyl-1,2,4-trioxolan-3-yl]undecanal.
| Compound Name | 11-[(3S,5S)-5-methyl-1,2,4-trioxolan-3-yl]undecanal |
|---|---|
| PubChem CID | 10801206 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 11-[(3S,5S)-5-methyl-1,2,4-trioxolan-3-yl]undecanal |
| SMILES | C[C@@H]1OO[C@@H](CCCCCCCCCCC=O)O1 |
| InChI | InChI=1S/C14H26O4/c1-13-16-14(18-17-13)11-9-7-5-3-2-4-6-8-10-12-15/h12-14H,2-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | JXVKDSJCPXZEOB-KBPBESRZSA-N |
| XLogP | 3.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|