C14H19NO4 — CID 10801632
phenyl-[(3R,4S)-2,3,4-trimethoxypyrrolidin-1-yl]methanone (PubChem CID 10801632) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is phenyl-[(3R,4S)-2,3,4-trimethoxypyrrolidin-1-yl]methanone.
| Compound Name | phenyl-[(3R,4S)-2,3,4-trimethoxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 10801632 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | phenyl-[(3R,4S)-2,3,4-trimethoxypyrrolidin-1-yl]methanone |
| SMILES | COC1[C@H](OC)[C@@H](OC)CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO4/c1-17-11-9-15(14(19-3)12(11)18-2)13(16)10-7-5-4-6-8-10/h4-8,11-12,14H,9H2,1-3H3/t11-,12+,14?/m0/s1 |
| InChIKey | ZAOHCXHVVXPVRM-KTYPHDMWSA-N |
| XLogP | 1.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |