C15H23NO3 — CID 10801650
(3aR,9aR)-5a-ethoxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one (PubChem CID 10801650) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (3aR,9aR)-5a-ethoxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one.
| Compound Name | (3aR,9aR)-5a-ethoxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one |
|---|---|
| PubChem CID | 10801650 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (3aR,9aR)-5a-ethoxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one |
| SMILES | C=CCN1C[C@@H]2COC3(OCC)CCCC[C@@]23C1=O |
| InChI | InChI=1S/C15H23NO3/c1-3-9-16-10-12-11-19-15(18-4-2)8-6-5-7-14(12,15)13(16)17/h3,12H,1,4-11H2,2H3/t12-,14+,15?/m1/s1 |
| InChIKey | GAQWVXXOPRWHCZ-JEIKQXNFSA-N |
| XLogP | 1.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|