C15H20LiNO3 — CID 10801901
lithium tert-butyl 5-methoxy-2-methyl-3,7-dihydro-2H-indol-7-ide-1-carboxylate (PubChem CID 10801901) has the molecular formula C15H20LiNO3 and a molecular weight of 269.27 g/mol. Its IUPAC name is lithium tert-butyl 5-methoxy-2-methyl-3,7-dihydro-2H-indol-7-ide-1-carboxylate.
| Compound Name | lithium tert-butyl 5-methoxy-2-methyl-3,7-dihydro-2H-indol-7-ide-1-carboxylate |
|---|---|
| PubChem CID | 10801901 |
| Molecular Formula | C15H20LiNO3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | lithium tert-butyl 5-methoxy-2-methyl-3,7-dihydro-2H-indol-7-ide-1-carboxylate |
| SMILES | COc1c[c-]c2c(c1)CC(C)N2C(=O)OC(C)(C)C.[Li+] |
| InChI | InChI=1S/C15H20NO3.Li/c1-10-8-11-9-12(18-5)6-7-13(11)16(10)14(17)19-15(2,3)4;/h6,9-10H,8H2,1-5H3;/q-1;+1 |
| InChIKey | SPDIZJWDYKPSNR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|