C14H18CuNO3 — CID 135045969
tert-butyl 5-methoxy-3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+) (PubChem CID 135045969) has the molecular formula C14H18CuNO3 and a molecular weight of 311.85 g/mol. Its IUPAC name is tert-butyl 5-methoxy-3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+).
| Compound Name | tert-butyl 5-methoxy-3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+) |
|---|---|
| PubChem CID | 135045969 |
| Molecular Formula | C14H18CuNO3 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | tert-butyl 5-methoxy-3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+) |
| SMILES | COc1c[c-]c2c(c1)CCN2C(=O)OC(C)(C)C.[Cu+] |
| InChI | InChI=1S/C14H18NO3.Cu/c1-14(2,3)18-13(16)15-8-7-10-9-11(17-4)5-6-12(10)15;/h5,9H,7-8H2,1-4H3;/q-1;+1 |
| InChIKey | FJNANKZCYSZBOS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|