C8H9NO2 — CID 142262002
3-methyl-4,5-dihydro-1,3-benzoxazol-2-one (PubChem CID 142262002) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-methyl-4,5-dihydro-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-4,5-dihydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 142262002 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-methyl-4,5-dihydro-1,3-benzoxazol-2-one |
| SMILES | Cn1c2c(oc1=O)C=CCC2 |
| InChI | InChI=1S/C8H9NO2/c1-9-6-4-2-3-5-7(6)11-8(9)10/h3,5H,2,4H2,1H3 |
| InChIKey | WIFBYZQASONOTF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |