C11H15NO2 — CID 143798284
ethane;3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one (PubChem CID 143798284) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is ethane;3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one.
| Compound Name | ethane;3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 143798284 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethane;3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one |
| SMILES | CC.Cn1c2c(oc1=O)C=CCC=C2 |
| InChI | InChI=1S/C9H9NO2.C2H6/c1-10-7-5-3-2-4-6-8(7)12-9(10)11;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | NRICUHGJOAFMDP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |