C13H19NO2 — CID 143342595
ethane;5-ethyl-3-methyl-8H-cyclohepta[d][1,3]oxazol-2-one (PubChem CID 143342595) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is ethane;5-ethyl-3-methyl-8H-cyclohepta[d][1,3]oxazol-2-one.
| Compound Name | ethane;5-ethyl-3-methyl-8H-cyclohepta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 143342595 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethane;5-ethyl-3-methyl-8H-cyclohepta[d][1,3]oxazol-2-one |
| SMILES | CC.CCC1=Cc2c(oc(=O)n2C)CC=C1 |
| InChI | InChI=1S/C11H13NO2.C2H6/c1-3-8-5-4-6-10-9(7-8)12(2)11(13)14-10;1-2/h4-5,7H,3,6H2,1-2H3;1-2H3 |
| InChIKey | KRJFNROPLVERNB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |