C9H9NO2 — CID 123382803
3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one (PubChem CID 123382803) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one.
| Compound Name | 3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 123382803 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-methyl-6H-cyclohepta[d][1,3]oxazol-2-one |
| SMILES | Cn1c2c(oc1=O)C=CCC=C2 |
| InChI | InChI=1S/C9H9NO2/c1-10-7-5-3-2-4-6-8(7)12-9(10)11/h3-6H,2H2,1H3 |
| InChIKey | MRRDSTXREMRYQY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |