C10H15NO2 — CID 143201376
4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one;ethane (PubChem CID 143201376) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one;ethane.
| Compound Name | 4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one;ethane |
|---|---|
| PubChem CID | 143201376 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one;ethane |
| SMILES | C=Cc1oc(=O)n(C)c1C=C.CC |
| InChI | InChI=1S/C8H9NO2.C2H6/c1-4-6-7(5-2)11-8(10)9(6)3;1-2/h4-5H,1-2H2,3H3;1-2H3 |
| InChIKey | RYTYHXXEMHSMJZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |