C9H10BrNO2 — CID 163823716
5-[(1E)-1-bromobuta-1,3-dienyl]-3,4-dimethyl-1,3-oxazol-2-one (PubChem CID 163823716) has the molecular formula C9H10BrNO2 and a molecular weight of 244.09 g/mol. Its IUPAC name is 5-[(1E)-1-bromobuta-1,3-dienyl]-3,4-dimethyl-1,3-oxazol-2-one.
| Compound Name | 5-[(1E)-1-bromobuta-1,3-dienyl]-3,4-dimethyl-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 163823716 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 5-[(1E)-1-bromobuta-1,3-dienyl]-3,4-dimethyl-1,3-oxazol-2-one |
| SMILES | C=C/C=C(/Br)c1oc(=O)n(C)c1C |
| InChI | InChI=1S/C9H10BrNO2/c1-4-5-7(10)8-6(2)11(3)9(12)13-8/h4-5H,1H2,2-3H3/b7-5+ |
| InChIKey | NXPYOJVJBSIBCC-FNORWQNLSA-N |
| XLogP | 2.21 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|