C8H9NO2 — CID 143201377
4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one (PubChem CID 143201377) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one.
| Compound Name | 4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 143201377 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 4,5-bis(ethenyl)-3-methyl-1,3-oxazol-2-one |
| SMILES | C=Cc1oc(=O)n(C)c1C=C |
| InChI | InChI=1S/C8H9NO2/c1-4-6-7(5-2)11-8(10)9(6)3/h4-5H,1-2H2,3H3 |
| InChIKey | QIPUDHRGIIJFNP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |