C10H11NO2 — CID 143839020
3,6-dimethyl-6H-cyclohepta[d][1,3]oxazol-2-one (PubChem CID 143839020) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 3,6-dimethyl-6H-cyclohepta[d][1,3]oxazol-2-one.
| Compound Name | 3,6-dimethyl-6H-cyclohepta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 143839020 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3,6-dimethyl-6H-cyclohepta[d][1,3]oxazol-2-one |
| SMILES | CC1C=Cc2oc(=O)n(C)c2C=C1 |
| InChI | InChI=1S/C10H11NO2/c1-7-3-5-8-9(6-4-7)13-10(12)11(8)2/h3-7H,1-2H3 |
| InChIKey | SUCHFAPOBUXROH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |