C14H19NO2 — CID 143588694
3,5-diethylcyclohepta[d][1,3]oxazol-2-one;ethane (PubChem CID 143588694) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3,5-diethylcyclohepta[d][1,3]oxazol-2-one;ethane.
| Compound Name | 3,5-diethylcyclohepta[d][1,3]oxazol-2-one;ethane |
|---|---|
| PubChem CID | 143588694 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3,5-diethylcyclohepta[d][1,3]oxazol-2-one;ethane |
| SMILES | CC.CCC1=Cc2c(oc(=O)n2CC)C=C=C1 |
| InChI | InChI=1S/C12H13NO2.C2H6/c1-3-9-6-5-7-11-10(8-9)13(4-2)12(14)15-11;1-2/h6-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | XQZAAANYYCODBU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |