C12H15NO3 — CID 141202819
ethyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate (PubChem CID 141202819) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
| Compound Name | ethyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
|---|---|
| PubChem CID | 141202819 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
| SMILES | CCOC(=O)N1C=CCOC2=C1CCC=C2 |
| InChI | InChI=1S/C12H15NO3/c1-2-15-12(14)13-8-5-9-16-11-7-4-3-6-10(11)13/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | ATBSSFZXLBKTLZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |