C13H17NO3 — CID 141202675
propan-2-yl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate (PubChem CID 141202675) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is propan-2-yl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
| Compound Name | propan-2-yl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
|---|---|
| PubChem CID | 141202675 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | propan-2-yl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
| SMILES | CC(C)OC(=O)N1C=CCOC2=C1CCC=C2 |
| InChI | InChI=1S/C13H17NO3/c1-10(2)17-13(15)14-8-5-9-16-12-7-4-3-6-11(12)14/h4-5,7-8,10H,3,6,9H2,1-2H3 |
| InChIKey | HPJZYJQWAMJQJC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |