C10H11NO3 — CID 12793535
7-methoxy-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one (PubChem CID 12793535) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one.
| Compound Name | 7-methoxy-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one |
|---|---|
| PubChem CID | 12793535 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 7-methoxy-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one |
| SMILES | COC1=CC=C2CCOC(=O)N2C=C1 |
| InChI | InChI=1S/C10H11NO3/c1-13-9-3-2-8-5-7-14-10(12)11(8)6-4-9/h2-4,6H,5,7H2,1H3 |
| InChIKey | HJRFNABXOZWSQF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |