About 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one
7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one (PubChem CID 12793537) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one.
Analyze 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
The IUPAC name of 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one (CID 12793537) is 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one.
What is the SMILES notation for 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
The canonical SMILES for 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one is CC1=CC=C2CCOC(=O)N2C=C1.
What is the InChIKey of 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
The InChIKey is ZAYIRFMQGWYSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-8-2-3-9-5-7-13-10(12)11(9)6-4-8/h2-4,6H,5,7H2,1H3.
What are the key properties of 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one has a molecular weight of 177.20 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one is sourced from PubChem (CID 12793537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).