C10H15NO2 — CID 13415533
ethyl 2,4-dimethyl-2H-pyridine-1-carboxylate (PubChem CID 13415533) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 13415533 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethyl 2,4-dimethyl-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1C=CC(C)=CC1C |
| InChI | InChI=1S/C10H15NO2/c1-4-13-10(12)11-6-5-8(2)7-9(11)3/h5-7,9H,4H2,1-3H3 |
| InChIKey | AXRQKEMDBWAPKX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |