C15H22N2O3 — CID 141202629
3-(dimethylamino)propyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate (PubChem CID 141202629) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
| Compound Name | 3-(dimethylamino)propyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
|---|---|
| PubChem CID | 141202629 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-(dimethylamino)propyl 6,7-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
| SMILES | CN(C)CCCOC(=O)N1C=CCOC2=C1CCC=C2 |
| InChI | InChI=1S/C15H22N2O3/c1-16(2)9-5-12-20-15(18)17-10-6-11-19-14-8-4-3-7-13(14)17/h4,6,8,10H,3,5,7,9,11-12H2,1-2H3 |
| InChIKey | VRASKOMXDJSDST-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|