C13H16CuNO2 — CID 135045942
tert-butyl 3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+) (PubChem CID 135045942) has the molecular formula C13H16CuNO2 and a molecular weight of 281.82 g/mol. Its IUPAC name is tert-butyl 3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+).
| Compound Name | tert-butyl 3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+) |
|---|---|
| PubChem CID | 135045942 |
| Molecular Formula | C13H16CuNO2 |
| Molecular Weight | 281.82 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | tert-butyl 3,7-dihydro-2H-indol-7-ide-1-carboxylate;copper(1+) |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc[c-]c21.[Cu+] |
| InChI | InChI=1S/C13H16NO2.Cu/c1-13(2,3)16-12(15)14-9-8-10-6-4-5-7-11(10)14;/h4-6H,8-9H2,1-3H3;/q-1;+1 |
| InChIKey | VCRBHEJHKYRKBI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.82 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|