C14H21NO2 — CID 123577229
tert-butyl 5-buta-1,3-dien-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 123577229) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is tert-butyl 5-buta-1,3-dien-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-buta-1,3-dien-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 123577229 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | tert-butyl 5-buta-1,3-dien-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CC(=C)C1=CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H21NO2/c1-6-11(2)12-8-7-9-15(10-12)13(16)17-14(3,4)5/h6,8H,1-2,7,9-10H2,3-5H3 |
| InChIKey | LTQVYRJPYGHWHP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|