C13H19NO2 — CID 141429376
tert-butyl 1,3,3a,4-tetrahydroisoindole-2-carboxylate (PubChem CID 141429376) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is tert-butyl 1,3,3a,4-tetrahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 1,3,3a,4-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 141429376 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | tert-butyl 1,3,3a,4-tetrahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC=CCC2C1 |
| InChI | InChI=1S/C13H19NO2/c1-13(2,3)16-12(15)14-8-10-6-4-5-7-11(10)9-14/h4-6,11H,7-9H2,1-3H3 |
| InChIKey | LFBLRZGQQPTVKH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |