C15H25NO2 — CID 123365143
tert-butyl N-(2-methylhexa-1,3-dien-3-yl)-N-prop-2-enylcarbamate (PubChem CID 123365143) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is tert-butyl N-(2-methylhexa-1,3-dien-3-yl)-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-(2-methylhexa-1,3-dien-3-yl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 123365143 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | tert-butyl N-(2-methylhexa-1,3-dien-3-yl)-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)C(=CCC)C(=C)C |
| InChI | InChI=1S/C15H25NO2/c1-8-10-13(12(3)4)16(11-9-2)14(17)18-15(5,6)7/h9-10H,2-3,8,11H2,1,4-7H3 |
| InChIKey | KAFHYQMCCXIEBT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|