C19H31NO2 — CID 134916005
tert-butyl 2,5-ditert-butylazepine-1-carboxylate (PubChem CID 134916005) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is tert-butyl 2,5-ditert-butylazepine-1-carboxylate.
| Compound Name | tert-butyl 2,5-ditert-butylazepine-1-carboxylate |
|---|---|
| PubChem CID | 134916005 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | tert-butyl 2,5-ditert-butylazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(C(C)(C)C)=CC=C1C(C)(C)C |
| InChI | InChI=1S/C19H31NO2/c1-17(2,3)14-10-11-15(18(4,5)6)20(13-12-14)16(21)22-19(7,8)9/h10-13H,1-9H3 |
| InChIKey | ZOFQWUJXNSHOOK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |