C17H23NO2 — CID 130343821
tert-butyl N-[(1E)-buta-1,3-dienyl]-N-(cyclohepta-1,3,5-trien-1-ylmethyl)carbamate (PubChem CID 130343821) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is tert-butyl N-[(1E)-buta-1,3-dienyl]-N-(cyclohepta-1,3,5-trien-1-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[(1E)-buta-1,3-dienyl]-N-(cyclohepta-1,3,5-trien-1-ylmethyl)carbamate |
|---|---|
| PubChem CID | 130343821 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | tert-butyl N-[(1E)-buta-1,3-dienyl]-N-(cyclohepta-1,3,5-trien-1-ylmethyl)carbamate |
| SMILES | C=C/C=C/N(CC1=CC=CC=CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO2/c1-5-6-13-18(16(19)20-17(2,3)4)14-15-11-9-7-8-10-12-15/h5-11,13H,1,12,14H2,2-4H3/b13-6+ |
| InChIKey | KBUZLHUMDFIPTR-AWNIVKPZSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|