C15H16N2O3 — CID 10802126
1,3,6-trimethyl-6-phenyl-5H-furo[2,3-d]pyrimidine-2,4-dione (PubChem CID 10802126) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1,3,6-trimethyl-6-phenyl-5H-furo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3,6-trimethyl-6-phenyl-5H-furo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10802126 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1,3,6-trimethyl-6-phenyl-5H-furo[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)CC(C)(c1ccccc1)O2 |
| InChI | InChI=1S/C15H16N2O3/c1-15(10-7-5-4-6-8-10)9-11-12(18)16(2)14(19)17(3)13(11)20-15/h4-8H,9H2,1-3H3 |
| InChIKey | CZLLWMCFHNSDRA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |