C20H24N2O2S — CID 11302755
(4bS,8aS)-1,3-diethyl-8a-phenyl-2-sulfanylidene-5,6,7,8-tetrahydro-4bH-[1]benzofuro[2,3-d]pyrimidin-4-one (PubChem CID 11302755) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is (4bS,8aS)-1,3-diethyl-8a-phenyl-2-sulfanylidene-5,6,7,8-tetrahydro-4bH-[1]benzofuro[2,3-d]pyrimidin-4-one.
| Compound Name | (4bS,8aS)-1,3-diethyl-8a-phenyl-2-sulfanylidene-5,6,7,8-tetrahydro-4bH-[1]benzofuro[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11302755 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (4bS,8aS)-1,3-diethyl-8a-phenyl-2-sulfanylidene-5,6,7,8-tetrahydro-4bH-[1]benzofuro[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c2c(c(=O)n(CC)c1=S)[C@@H]1CCCC[C@]1(c1ccccc1)O2 |
| InChI | InChI=1S/C20H24N2O2S/c1-3-21-17(23)16-15-12-8-9-13-20(15,14-10-6-5-7-11-14)24-18(16)22(4-2)19(21)25/h5-7,10-11,15H,3-4,8-9,12-13H2,1-2H3/t15-,20+/m0/s1 |
| InChIKey | DYWZVSFYPLUNKA-MGPUTAFESA-N |
| XLogP | 4.36 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|