C14H24O5 — CID 10802138
[(1S,4Z,8S)-8-(2-methoxyethoxymethoxy)cyclooct-4-en-1-yl] acetate (PubChem CID 10802138) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is [(1S,4Z,8S)-8-(2-methoxyethoxymethoxy)cyclooct-4-en-1-yl] acetate.
| Compound Name | [(1S,4Z,8S)-8-(2-methoxyethoxymethoxy)cyclooct-4-en-1-yl] acetate |
|---|---|
| PubChem CID | 10802138 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [(1S,4Z,8S)-8-(2-methoxyethoxymethoxy)cyclooct-4-en-1-yl] acetate |
| SMILES | COCCOCO[C@H]1CC/C=C\CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H24O5/c1-12(15)19-14-8-6-4-3-5-7-13(14)18-11-17-10-9-16-2/h3-4,13-14H,5-11H2,1-2H3/b4-3-/t13-,14-/m0/s1 |
| InChIKey | KGZVCBCYMQHLBF-NMEQGOOXSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|