C13H24O6 — CID 134839712
[(4R,5S,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-yl] acetate (PubChem CID 134839712) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is [(4R,5S,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-yl] acetate.
| Compound Name | [(4R,5S,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-yl] acetate |
|---|---|
| PubChem CID | 134839712 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [(4R,5S,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-yl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@@H](OCOC)[C@@H](C)OCOC |
| InChI | InChI=1S/C13H24O6/c1-6-7-12(19-11(3)14)13(18-9-16-5)10(2)17-8-15-4/h6,10,12-13H,1,7-9H2,2-5H3/t10-,12-,13+/m1/s1 |
| InChIKey | NGLKPZXKQIEGBI-RTXFEEFZSA-N |
| XLogP | 1.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|