C14H24O4 — CID 134857150
[(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 134857150) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is [(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134857150 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | [(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H24O4/c1-7-8-10-11(18-14(5,6)17-10)9-16-12(15)13(2,3)4/h7,10-11H,1,8-9H2,2-6H3/t10-,11-/m0/s1 |
| InChIKey | OWOKHQXOWFCZQN-QWRGUYRKSA-N |
| XLogP | 2.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|