C18H20N2O — CID 10802716
(1R,11S,12E,17R)-12-ethylidene-8-oxido-14-aza-8-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene (PubChem CID 10802716) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (1R,11S,12E,17R)-12-ethylidene-8-oxido-14-aza-8-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene.
| Compound Name | (1R,11S,12E,17R)-12-ethylidene-8-oxido-14-aza-8-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 10802716 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (1R,11S,12E,17R)-12-ethylidene-8-oxido-14-aza-8-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene |
| SMILES | C/C=C1/CN2CC[C@@]34C(=[N+]([O-])c5ccccc53)C[C@@H]1C[C@@H]24 |
| InChI | InChI=1S/C18H20N2O/c1-2-12-11-19-8-7-18-14-5-3-4-6-15(14)20(21)17(18)10-13(12)9-16(18)19/h2-6,13,16H,7-11H2,1H3/b12-2-/t13-,16+,18+/m0/s1 |
| InChIKey | IYXAYLIEQLYNND-MUYMPNGXSA-N |
| XLogP | 2.96 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|