C19H20N2 — CID 162891330
(1R,11S,17S)-12-ethylidene-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene (PubChem CID 162891330) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1R,11S,17S)-12-ethylidene-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene.
| Compound Name | (1R,11S,17S)-12-ethylidene-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 162891330 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (1R,11S,17S)-12-ethylidene-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,8-tetraene |
| SMILES | C=C1C2=Nc3ccccc3[C@@]23CCN2CC(=CC)[C@@H]1C[C@H]23 |
| InChI | InChI=1S/C19H20N2/c1-3-13-11-21-9-8-19-15-6-4-5-7-16(15)20-18(19)12(2)14(13)10-17(19)21/h3-7,14,17H,2,8-11H2,1H3/t14-,17+,19-/m1/s1 |
| InChIKey | KFXIUXCXSKTCNK-DKSSEZFCSA-N |
| XLogP | 3.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|