C11H11N5O2 — CID 10802802
N-(diaminomethylidene)-7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxamide (PubChem CID 10802802) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is N-(diaminomethylidene)-7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 10802802 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(diaminomethylidene)-7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1ccc2c(=O)c(C(=O)N=C(N)N)c[nH]c2n1 |
| InChI | InChI=1S/C11H11N5O2/c1-5-2-3-6-8(17)7(4-14-9(6)15-5)10(18)16-11(12)13/h2-4H,1H3,(H,14,15,17)(H4,12,13,16,18) |
| InChIKey | QCQYAKAEWAOAGZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|