C11H10N2O3 — CID 147507545
tritio 1,7-dimethyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 147507545) has the molecular formula C11H10N2O3 and a molecular weight of 220.22 g/mol. Its IUPAC name is tritio 1,7-dimethyl-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | tritio 1,7-dimethyl-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 147507545 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | tritio 1,7-dimethyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | [3H]OC(=O)c1cn(C)c2nc(C)ccc2c1=O |
| InChI | InChI=1S/C11H10N2O3/c1-6-3-4-7-9(14)8(11(15)16)5-13(2)10(7)12-6/h3-5H,1-2H3,(H,15,16)/i/hT |
| InChIKey | FIQGPIHRUIEFQF-MNYXATJNSA-N |
| XLogP | 0.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |