C24H24FNO6 — CID 1080381
(5R)-5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione (PubChem CID 1080381) has the molecular formula C24H24FNO6 and a molecular weight of 441.46 g/mol. Its IUPAC name is (5R)-5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1080381 |
| Molecular Formula | C24H24FNO6 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (5R)-5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@@H]2C(=C(O)c3ccc(F)cc3)C(=O)C(=O)N2C[C@H]2CCCO2)ccc1O |
| InChI | InChI=1S/C24H24FNO6/c1-2-31-19-12-15(7-10-18(19)27)21-20(22(28)14-5-8-16(25)9-6-14)23(29)24(30)26(21)13-17-4-3-11-32-17/h5-10,12,17,21,27-28H,2-4,11,13H2,1H3/t17-,21-/m1/s1 |
| InChIKey | NPZRULFQAIFENH-DYESRHJHSA-N |
| XLogP | 3.53 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|