C26H29NO7 — CID 5093566
5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 5093566) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5093566 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 5-(3-ethoxy-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C(O)=C2C(=O)C(=O)N(CC3CCCO3)C2c2ccc(O)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H29NO7/c1-3-32-18-10-7-16(8-11-18)24(29)22-23(17-9-12-20(28)21(14-17)33-4-2)27(26(31)25(22)30)15-19-6-5-13-34-19/h7-12,14,19,23,28-29H,3-6,13,15H2,1-2H3 |
| InChIKey | RFRLRWNGPMDIGY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|