C14H25NO4S — CID 10804409
tert-butyl 2-[[(2S,3S)-2-acetylsulfanyl-3-methylpentanoyl]amino]acetate (PubChem CID 10804409) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is tert-butyl 2-[[(2S,3S)-2-acetylsulfanyl-3-methylpentanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2S,3S)-2-acetylsulfanyl-3-methylpentanoyl]amino]acetate |
|---|---|
| PubChem CID | 10804409 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | tert-butyl 2-[[(2S,3S)-2-acetylsulfanyl-3-methylpentanoyl]amino]acetate |
| SMILES | CC[C@H](C)[C@H](SC(C)=O)C(=O)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4S/c1-7-9(2)12(20-10(3)16)13(18)15-8-11(17)19-14(4,5)6/h9,12H,7-8H2,1-6H3,(H,15,18)/t9-,12-/m0/s1 |
| InChIKey | RWXJYOHOLVELDB-CABZTGNLSA-N |
| XLogP | 2.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|