C17H16N2O4 — CID 10805047
(4R)-3-[(1R)-2-nitro-1-phenylethyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10805047) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is (4R)-3-[(1R)-2-nitro-1-phenylethyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(1R)-2-nitro-1-phenylethyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10805047 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (4R)-3-[(1R)-2-nitro-1-phenylethyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H16N2O4/c20-17-19(16(12-23-17)14-9-5-2-6-10-14)15(11-18(21)22)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16-/m0/s1 |
| InChIKey | TXXQPNWGTWILFL-HOTGVXAUSA-N |
| XLogP | 3.20 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|