C16H15NO2 — CID 11357228
(4R)-3-benzyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11357228) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (4R)-3-benzyl-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-benzyl-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11357228 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (4R)-3-benzyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c18-16-17(11-13-7-3-1-4-8-13)15(12-19-16)14-9-5-2-6-10-14/h1-10,15H,11-12H2/t15-/m0/s1 |
| InChIKey | LAAMWNFNYBXBTK-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |