C12H17N3O3S2 — CID 10805301
N-(diaminomethylidene)-4-ethylsulfanyl-2-methyl-5-methylsulfonylbenzamide (PubChem CID 10805301) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-ethylsulfanyl-2-methyl-5-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-ethylsulfanyl-2-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 10805301 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(diaminomethylidene)-4-ethylsulfanyl-2-methyl-5-methylsulfonylbenzamide |
| SMILES | CCSc1cc(C)c(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H17N3O3S2/c1-4-19-9-5-7(2)8(11(16)15-12(13)14)6-10(9)20(3,17)18/h5-6H,4H2,1-3H3,(H4,13,14,15,16) |
| InChIKey | ZCJPIEUPMZZNJN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|