C19H15N3S — CID 10805459
2-[(E)-(3-benzyl-1,3-thiazolidin-2-ylidene)-cyanomethyl]benzonitrile (PubChem CID 10805459) has the molecular formula C19H15N3S and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-[(E)-(3-benzyl-1,3-thiazolidin-2-ylidene)-cyanomethyl]benzonitrile.
| Compound Name | 2-[(E)-(3-benzyl-1,3-thiazolidin-2-ylidene)-cyanomethyl]benzonitrile |
|---|---|
| PubChem CID | 10805459 |
| Molecular Formula | C19H15N3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[(E)-(3-benzyl-1,3-thiazolidin-2-ylidene)-cyanomethyl]benzonitrile |
| SMILES | N#C/C(=C1/SCCN1Cc1ccccc1)c1ccccc1C#N |
| InChI | InChI=1S/C19H15N3S/c20-12-16-8-4-5-9-17(16)18(13-21)19-22(10-11-23-19)14-15-6-2-1-3-7-15/h1-9H,10-11,14H2/b19-18- |
| InChIKey | HYXARFNUAURMQW-HNENSFHCSA-N |
| XLogP | 4.00 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|